CAS 827-20-3 appears in our catalog under these names: 5–Fluoro–2–(trifluoromethyl)aniline, 5-Fluoro-2-(trifluoromethyl)aniline 98%, 5-Fluoro-2-(trifluoromethyl)aniline, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
5-fluoro-2-(trifluoromethyl)aniline (CAS 827-20-3) is a chemical compound with the molecular formula C7H5F4N and a molecular weight of 179.11 g/mol. IUPAC name: 5-fluoro-2-(trifluoromethyl)aniline. InChIKey: LBSBTIMHMYAFFS-UHFFFAOYSA-N.
| Molecular formula | C7H5F4N |
|---|---|
| Molecular weight | 179.11 g/mol |
| IUPAC name | 5-fluoro-2-(trifluoromethyl)aniline |
| InChIKey | LBSBTIMHMYAFFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N)C(F)(F)F |
Computed by PubChem (NCBI)