cas: 19541-95-8 — see every product listed under this CAS number, including other names
3-Amino-5-(4-methoxyphenyl)pyrazole, 98% (CAS 19541-95-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F012259-5G |
| cas | 19541-95-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 351.98 Pln | |
| Fluorochem | 10g | 544.62 Pln | |
| Fluorochem | 25g | 1018.41 Pln | |
| Fluorochem | 100g | 2799.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-(4-methoxyphenyl)-1H-pyrazol-3-amine (CAS 19541-95-8) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 5-(4-methoxyphenyl)-1H-pyrazol-3-amine. InChIKey: UPAGEJODHNVJNM-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-1H-pyrazol-3-amine |
| InChIKey | UPAGEJODHNVJNM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=NN2)N |
Computed by PubChem (NCBI)