CAS 28798-81-4 is the registry number for (1-Benzyl-1h-1,2,3-triazol-4-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1-benzyltriazol-4-yl)methanol (CAS 28798-81-4) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: (1-benzyltriazol-4-yl)methanol. InChIKey: SXNXKULRKDCYLM-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (1-benzyltriazol-4-yl)methanol |
| InChIKey | SXNXKULRKDCYLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=N2)CO |
Computed by PubChem (NCBI)