3-Amino-5-Chloro-4-Methylbenzenesulfonic Acid, 95%
cas: 6387-27-5 — see every product listed under this CAS number, including other names
3-Amino-5-Chloro-4-Methylbenzenesulfonic Acid, 95% (CAS 6387-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11EHHZ-100mg |
| cas | 6387-27-5 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 880.40 Pln | |
| Chemat | 1g | 1787.60 Pln | |
| Chemat | 5g | 5997.20 Pln | |
| Fluorochem | 250mg | 1200.64 Pln | |
| Fluorochem | 1g | 2455.40 Pln | |
| Fluorochem | 5g | 8041.98 Pln | |
| Fluorochem | 100mg | 742.46 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-amino-5-chloro-4-methylbenzenesulfonic acid (CAS 6387-27-5) is a chemical compound with the molecular formula C7H8ClNO3S and a molecular weight of 221.66 g/mol. IUPAC name: 3-amino-5-chloro-4-methylbenzenesulfonic acid. InChIKey: RSCRGMCYBCTJGF-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO3S |
|---|---|
| Molecular weight | 221.66 g/mol |
| IUPAC name | 3-amino-5-chloro-4-methylbenzenesulfonic acid |
| InChIKey | RSCRGMCYBCTJGF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)S(=O)(=O)O)N |
Computed by PubChem (NCBI)