3-Aminoadamantane-1-carboxylic acid hydrochloride, 95%
cas: 6240-01-3 — see every product listed under this CAS number, including other names
3-Aminoadamantane-1-carboxylic acid hydrochloride, 95% (CAS 6240-01-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A847500-250mg |
| cas | 6240-01-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 887.69 Pln | |
| Ambeed | 25g | 3579.94 Pln | |
| Ambeed | 100g | 11289.56 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 264.38 Pln | |
| BLDpharm | 5g | 953.02 Pln | |
| BLDpharm | 25g | 3852.00 Pln | |
| BLDpharm | 100g | 12165.74 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-aminoadamantane-1-carboxylic acid;hydrochloride (CAS 6240-01-3) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. IUPAC name: 3-aminoadamantane-1-carboxylic acid;hydrochloride. InChIKey: CMUAQGBJDDHTPE-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO2 |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | 3-aminoadamantane-1-carboxylic acid;hydrochloride |
| InChIKey | CMUAQGBJDDHTPE-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)N)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-aminoadamantane-1-carboxylic acid hydrochloride, 3-Amino-1-adamantanecarboxylic acid hydrochloride, 3-aminoadamantane-1-carboxylic acid;hydrochloride, 1-Amino-3-adamantanecarboxylic acid hydrochloride, 3-Amino-adamantane-1-carboxylic acid hydrochloride, (1r,3s,5R,7S)-3-aminoadamantane-1-carboxylic acid hydrochloride, 3-Aminoadamantane-1-carboxylic Acid HCl, CMUAQGBJDDH, Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 3-amino-, hydrochloride, 3-Aminoadamantane-1-carboxylicAcidHydrochloride