CAS 923177-26-8 is the registry number for 1-(Chloroacetyl)-2,2,6,6-tetramethylpiperidin-4-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 100mg, 1g.
1-(2-chloroacetyl)-2,2,6,6-tetramethylpiperidin-4-one (CAS 923177-26-8) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. IUPAC name: 1-(2-chloroacetyl)-2,2,6,6-tetramethylpiperidin-4-one. InChIKey: XTCZSUBKOLIPDK-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO2 |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | 1-(2-chloroacetyl)-2,2,6,6-tetramethylpiperidin-4-one |
| InChIKey | XTCZSUBKOLIPDK-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)CC(N1C(=O)CCl)(C)C)C |
Computed by PubChem (NCBI)