Products 2061996-57-2
CAS 2061996-57-2 appears in our catalog under these names: (S)-1-(3,5-Dimethoxyphenyl)propan-1-amine hydrochloride, 95%, (S)–1–(3，5–Dimethoxyphenyl)propan–1–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(1S)-1-(3,5-dimethoxyphenyl)propan-1-amine;hydrochloride (CAS 2061996-57-2) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. IUPAC name: (1S)-1-(3,5-dimethoxyphenyl)propan-1-amine;hydrochloride. InChIKey: CVWSVJFSUQWPMZ-MERQFXBCSA-N.
| Molecular formula | C11H18ClNO2 |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | (1S)-1-(3,5-dimethoxyphenyl)propan-1-amine;hydrochloride |
| InChIKey | CVWSVJFSUQWPMZ-MERQFXBCSA-N |
| SMILES | CC[C@@H](C1=CC(=CC(=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)