Products 17970-63-7

CAS 17970-63-7 is the registry number for 1-Amino-3-(2,6-dimethylphenoxy)propan-2-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

1-amino-3-(2,6-dimethylphenoxy)propan-2-ol;hydrochloride (CAS 17970-63-7) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. IUPAC name: 1-amino-3-(2,6-dimethylphenoxy)propan-2-ol;hydrochloride. InChIKey: UOCASSCDNBSABH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18ClNO2
Molecular weight231.72 g/mol
IUPAC name1-amino-3-(2,6-dimethylphenoxy)propan-2-ol;hydrochloride
InChIKeyUOCASSCDNBSABH-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C)OCC(CN)O.Cl

Computed by PubChem (NCBI)