Products 1389264-13-4

CAS 1389264-13-4 is the registry number for 2-Aza-tricyclo[3.3.1.1(3,7)]decane-5-carboxylic acid methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 2-azatricyclo[3.3.1.13,7]decane-5-carboxylate;hydrochloride (CAS 1389264-13-4) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. IUPAC name: methyl 2-azatricyclo[3.3.1.13,7]decane-5-carboxylate;hydrochloride. InChIKey: MMRKEVAQVFREIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18ClNO2
Molecular weight231.72 g/mol
IUPAC namemethyl 2-azatricyclo[3.3.1.13,7]decane-5-carboxylate;hydrochloride
InChIKeyMMRKEVAQVFREIQ-UHFFFAOYSA-N
SMILESCOC(=O)C12CC3CC(C1)NC(C3)C2.Cl

Computed by PubChem (NCBI)