cas: 1073354-99-0 — see every product listed under this CAS number, including other names
3-Aminopyridine-5-boronic acid, pinacol ester 95% (CAS 1073354-99-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A218050-250mg |
| cas | 1073354-99-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 392.62 Pln | |
| Ambeed | 10g | 715.25 Pln | |
| Ambeed | 25g | 1677.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A218050 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine (CAS 1073354-99-0) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine. InChIKey: DAISWHFZWZZBBD-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine |
| InChIKey | DAISWHFZWZZBBD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)N |
Computed by PubChem (NCBI)