cas: 836627-56-6 — see every product listed under this CAS number, including other names
3-BROMO-N,N-DIMETHYL-4-OXO-4-(P-TOLYL)BUTANAMIDE, 96% (CAS 836627-56-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F844225-100MG |
| cas | 836627-56-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1684.84 Pln | |
| Fluorochem | 250mg | 2913.58 Pln | |
| Fluorochem | 1g | 5777.15 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-N,N-dimethyl-4-(4-methylphenyl)-4-oxobutanamide (CAS 836627-56-6) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: 3-bromo-N,N-dimethyl-4-(4-methylphenyl)-4-oxobutanamide. InChIKey: BROZCDKHLQPLCX-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | 3-bromo-N,N-dimethyl-4-(4-methylphenyl)-4-oxobutanamide |
| InChIKey | BROZCDKHLQPLCX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(CC(=O)N(C)C)Br |
Computed by PubChem (NCBI)