CAS 1369785-59-0 is the registry number for 5-Bromo-2-(cyclopropylmethoxy)-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-2-(cyclopropylmethoxy)-N,N-dimethylbenzamide (CAS 1369785-59-0) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: 5-bromo-2-(cyclopropylmethoxy)-N,N-dimethylbenzamide. InChIKey: SYVVFVVQLUEBFM-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | 5-bromo-2-(cyclopropylmethoxy)-N,N-dimethylbenzamide |
| InChIKey | SYVVFVVQLUEBFM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)Br)OCC2CC2 |
Computed by PubChem (NCBI)