Products 213690-00-7
CAS 213690-00-7 is the registry number for 1-(5-Bromo-2-hydroxyphenyl)-3-(diethylamino)-2-propen-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
1-(5-bromo-2-hydroxyphenyl)-3-(diethylamino)prop-2-en-1-one (CAS 213690-00-7) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: 1-(5-bromo-2-hydroxyphenyl)-3-(diethylamino)prop-2-en-1-one. InChIKey: WGCAWTUPPWTJJF-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | 1-(5-bromo-2-hydroxyphenyl)-3-(diethylamino)prop-2-en-1-one |
| InChIKey | WGCAWTUPPWTJJF-UHFFFAOYSA-N |
| SMILES | CCN(CC)C=CC(=O)C1=C(C=CC(=C1)Br)O |
Computed by PubChem (NCBI)