Products 2270912-16-6

CAS 2270912-16-6 is the registry number for 3-(5-Bromo-3,4-dihydro-1h-isoquinolin-2-yl)-propionic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)propanoate (CAS 2270912-16-6) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: methyl 3-(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)propanoate. InChIKey: YLJPLZGMFTXAAD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16BrNO2
Molecular weight298.18 g/mol
IUPAC namemethyl 3-(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)propanoate
InChIKeyYLJPLZGMFTXAAD-UHFFFAOYSA-N
SMILESCOC(=O)CCN1CCC2=C(C1)C=CC=C2Br

Computed by PubChem (NCBI)