Products 1431365-58-0
CAS 1431365-58-0 is the registry number for Cis-tert-butyl 3-(4-bromophenyl)aziridine-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (2R,3R)-3-(4-bromophenyl)aziridine-2-carboxylate (CAS 1431365-58-0) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: tert-butyl (2R,3R)-3-(4-bromophenyl)aziridine-2-carboxylate. InChIKey: GRXWSFQIYGHTOU-GHMZBOCLSA-N.
| Molecular formula | C13H16BrNO2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | tert-butyl (2R,3R)-3-(4-bromophenyl)aziridine-2-carboxylate |
| InChIKey | GRXWSFQIYGHTOU-GHMZBOCLSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]1[C@H](N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)