cas: 174680-55-8 — see every product listed under this CAS number, including other names
3-Benzyl-5-bromopyrazin-2-amine, 95% (CAS 174680-55-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619268-100MG |
| cas | 174680-55-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 607.10 Pln | |
| Fluorochem | 250mg | 976.76 Pln | |
| Fluorochem | 1g | 1903.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-benzyl-5-bromopyrazin-2-amine (CAS 174680-55-8) is a chemical compound with the molecular formula C11H10BrN3 and a molecular weight of 264.12 g/mol. IUPAC name: 3-benzyl-5-bromopyrazin-2-amine. InChIKey: ZHWYHVYXEQYEQV-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3 |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 3-benzyl-5-bromopyrazin-2-amine |
| InChIKey | ZHWYHVYXEQYEQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CN=C2N)Br |
Computed by PubChem (NCBI)