CAS 174680-55-8 appears in our catalog under these names: 3-Benzyl-5-Bromopyrazin-2-Amine, 95%, 95%, 3-Benzyl-5-bromopyrazin-2-amine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-benzyl-5-bromopyrazin-2-amine (CAS 174680-55-8) is a chemical compound with the molecular formula C11H10BrN3 and a molecular weight of 264.12 g/mol. IUPAC name: 3-benzyl-5-bromopyrazin-2-amine. InChIKey: ZHWYHVYXEQYEQV-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3 |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 3-benzyl-5-bromopyrazin-2-amine |
| InChIKey | ZHWYHVYXEQYEQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CN=C2N)Br |
Computed by PubChem (NCBI)