CAS 38373-55-6 is the registry number for 2-Benzylamino-5-bromopyrimidine, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
N-benzyl-5-bromopyrimidin-2-amine (CAS 38373-55-6) is a chemical compound with the molecular formula C11H10BrN3 and a molecular weight of 264.12 g/mol. IUPAC name: N-benzyl-5-bromopyrimidin-2-amine. InChIKey: SEJMYSXXRMYOGT-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3 |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | N-benzyl-5-bromopyrimidin-2-amine |
| InChIKey | SEJMYSXXRMYOGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)