CAS 850663-79-5 is the registry number for 6–bromo–N4–phenyl–3,4–pyridinediamine. Offered by: GLPBio. Available pack sizes: 200mg.
6-bromo-4-N-phenylpyridine-3,4-diamine (CAS 850663-79-5) is a chemical compound with the molecular formula C11H10BrN3 and a molecular weight of 264.12 g/mol. IUPAC name: 6-bromo-4-N-phenylpyridine-3,4-diamine. InChIKey: JVAGMQZETVWJIH-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3 |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 6-bromo-4-N-phenylpyridine-3,4-diamine |
| InChIKey | JVAGMQZETVWJIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=NC=C2N)Br |
Computed by PubChem (NCBI)