Products 78750-67-1
CAS 78750-67-1 is the registry number for 2-N-(4-Bromophenyl)pyridine-2,3-diamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-N-(4-bromophenyl)pyridine-2,3-diamine (CAS 78750-67-1) is a chemical compound with the molecular formula C11H10BrN3 and a molecular weight of 264.12 g/mol. IUPAC name: 2-N-(4-bromophenyl)pyridine-2,3-diamine. InChIKey: ZGNHBCKUJFEGNT-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3 |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 2-N-(4-bromophenyl)pyridine-2,3-diamine |
| InChIKey | ZGNHBCKUJFEGNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NC2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)