cas: 627527-23-5 — see every product listed under this CAS number, including other names
3-BroMo-5-(trifluoroMethyl)anisole, 98%, 98% (CAS 627527-23-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147ZJ-1g |
| cas | 627527-23-5 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 194.00 Pln | |
| Chemat | 25g | 323.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3-methoxy-5-(trifluoromethyl)benzene (CAS 627527-23-5) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 1-bromo-3-methoxy-5-(trifluoromethyl)benzene. InChIKey: IBEKZIYJONXDRY-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 1-bromo-3-methoxy-5-(trifluoromethyl)benzene |
| InChIKey | IBEKZIYJONXDRY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)