CAS 1185308-47-7 is the registry number for 3–Trifluoromethyl–5–(methoxy–d3)–bromobenzene. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
1-bromo-3-(trideuteriomethoxy)-5-(trifluoromethyl)benzene (CAS 1185308-47-7) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 258.05 g/mol. IUPAC name: 1-bromo-3-(trideuteriomethoxy)-5-(trifluoromethyl)benzene. InChIKey: IBEKZIYJONXDRY-FIBGUPNXSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 1-bromo-3-(trideuteriomethoxy)-5-(trifluoromethyl)benzene |
| InChIKey | IBEKZIYJONXDRY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)