cas: 1049706-73-1 — see every product listed under this CAS number, including other names
3-Bromo-2-chloro-4-methyl-5-nitropyridine 98% (CAS 1049706-73-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A441685-100mg |
| cas | 1049706-73-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 793.12 Pln | |
| Ambeed | 25g | 3663.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A441685 |
3-bromo-2-chloro-4-methyl-5-nitropyridine (CAS 1049706-73-1) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 3-bromo-2-chloro-4-methyl-5-nitropyridine. InChIKey: QGEFBUJRBVNTFX-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN2O2 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 3-bromo-2-chloro-4-methyl-5-nitropyridine |
| InChIKey | QGEFBUJRBVNTFX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)