cas: 1049706-73-1 — see every product listed under this CAS number, including other names
3-Bromo-2-chloro-4-methyl-5-nitropyridine, 98%, 98% (CAS 1049706-73-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119ZAV-100mg |
| cas | 1049706-73-1 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 818.00 Pln | |
| Chemat | 25g | 1576.40 Pln | |
| Chemat | 50g | 2958.80 Pln | |
| Chemat | 100g | 4542.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-2-chloro-4-methyl-5-nitropyridine (CAS 1049706-73-1) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 3-bromo-2-chloro-4-methyl-5-nitropyridine. InChIKey: QGEFBUJRBVNTFX-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN2O2 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 3-bromo-2-chloro-4-methyl-5-nitropyridine |
| InChIKey | QGEFBUJRBVNTFX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)