cas: 352534-82-8 — see every product listed under this CAS number, including other names
3-Bromo-2-ethoxy-5-fluorophenylboronic acid, 95%, 95% (CAS 352534-82-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J1A-1g |
| cas | 352534-82-8 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 923.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3-bromo-2-ethoxy-5-fluorophenyl)boronic acid (CAS 352534-82-8) is a chemical compound with the molecular formula C8H9BBrFO3 and a molecular weight of 262.87 g/mol. IUPAC name: (3-bromo-2-ethoxy-5-fluorophenyl)boronic acid. InChIKey: VCQYFCFOYYCYJA-UHFFFAOYSA-N.
| Molecular formula | C8H9BBrFO3 |
|---|---|
| Molecular weight | 262.87 g/mol |
| IUPAC name | (3-bromo-2-ethoxy-5-fluorophenyl)boronic acid |
| InChIKey | VCQYFCFOYYCYJA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OCC)Br)F)(O)O |
Computed by PubChem (NCBI)