CAS 871126-14-6 appears in our catalog under these names: 6-Bromo-3-ethoxy-2-fluorophenylboronic acid, 98%, (6-Bromo-3-ethoxy-2-fluorophenyl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 100g, 500g, 1g.
(6-bromo-3-ethoxy-2-fluorophenyl)boronic acid (CAS 871126-14-6) is a chemical compound with the molecular formula C8H9BBrFO3 and a molecular weight of 262.87 g/mol. IUPAC name: (6-bromo-3-ethoxy-2-fluorophenyl)boronic acid. InChIKey: GCNQUSXPZGIAQM-UHFFFAOYSA-N.
| Molecular formula | C8H9BBrFO3 |
|---|---|
| Molecular weight | 262.87 g/mol |
| IUPAC name | (6-bromo-3-ethoxy-2-fluorophenyl)boronic acid |
| InChIKey | GCNQUSXPZGIAQM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OCC)Br)(O)O |
Computed by PubChem (NCBI)