Products 1315340-54-5
CAS 1315340-54-5 appears in our catalog under these names: 5-Bromo-6-ethoxy-2-fluorophenylboronic acid, 3-Bromo-2-ethoxy-6-fluorophenylboronic acid, 95%, (3-Bromo-2-ethoxy-6-fluorophenyl)boronic acid, 98+%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
(3-bromo-2-ethoxy-6-fluorophenyl)boronic acid (CAS 1315340-54-5) is a chemical compound with the molecular formula C8H9BBrFO3 and a molecular weight of 262.87 g/mol. IUPAC name: (3-bromo-2-ethoxy-6-fluorophenyl)boronic acid. InChIKey: CQJCRITVZWAMKV-UHFFFAOYSA-N.
| Molecular formula | C8H9BBrFO3 |
|---|---|
| Molecular weight | 262.87 g/mol |
| IUPAC name | (3-bromo-2-ethoxy-6-fluorophenyl)boronic acid |
| InChIKey | CQJCRITVZWAMKV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1OCC)Br)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Bromo-2-fluoro-6-ethoxyphenylboronic acid, 5-Bromo-6-ethoxy-2-fluorophenylboronic acid, (3-Bromo-2-ethoxy-6-fluorophenyl)boronic acid, 3-bromo-2-ethoxy-6-fluorophenylboronic acid, 2-Ethoxy-3-bromo-6-fluorophenylboronic acid, (3-bromo-2-ethoxy-6-fluoro-phenyl)boronic acid, Boronic acid, B-(3-bromo-2-ethoxy-6-fluorophenyl)-