CAS 1310403-98-5 appears in our catalog under these names: (6–Bromo–2–ethoxy–3–fluorophenyl)boronic acid, (6-Bromo-2-ethoxy-3-fluorophenyl)boronic acid 95%, 6-Bromo-2-ethoxy-3-fluorophenylboronic acid, 95%, 95%, (6-Bromo-2-ethoxy-3-fluorophenyl)boronic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
(6-bromo-2-ethoxy-3-fluorophenyl)boronic acid (CAS 1310403-98-5) is a chemical compound with the molecular formula C8H9BBrFO3 and a molecular weight of 262.87 g/mol. IUPAC name: (6-bromo-2-ethoxy-3-fluorophenyl)boronic acid. InChIKey: UKBDAFLNQDNKIH-UHFFFAOYSA-N.
| Molecular formula | C8H9BBrFO3 |
|---|---|
| Molecular weight | 262.87 g/mol |
| IUPAC name | (6-bromo-2-ethoxy-3-fluorophenyl)boronic acid |
| InChIKey | UKBDAFLNQDNKIH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1OCC)F)Br)(O)O |
Computed by PubChem (NCBI)