Products 1315340-56-7

CAS 1315340-56-7 appears in our catalog under these names: (4–Bromo–2–ethoxy–6–fluorophenyl)boronic acid, (4-Bromo-2-ethoxy-6-fluorophenyl)boronic acid 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(4-bromo-2-ethoxy-6-fluorophenyl)boronic acid (CAS 1315340-56-7) is a chemical compound with the molecular formula C8H9BBrFO3 and a molecular weight of 262.87 g/mol. IUPAC name: (4-bromo-2-ethoxy-6-fluorophenyl)boronic acid. InChIKey: QIAHCZUMIHBXQO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9BBrFO3
Molecular weight262.87 g/mol
IUPAC name(4-bromo-2-ethoxy-6-fluorophenyl)boronic acid
InChIKeyQIAHCZUMIHBXQO-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1F)Br)OCC)(O)O

Computed by PubChem (NCBI)