CAS 1315340-56-7 appears in our catalog under these names: (4–Bromo–2–ethoxy–6–fluorophenyl)boronic acid, (4-Bromo-2-ethoxy-6-fluorophenyl)boronic acid 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 1g, 5g.
(4-bromo-2-ethoxy-6-fluorophenyl)boronic acid (CAS 1315340-56-7) is a chemical compound with the molecular formula C8H9BBrFO3 and a molecular weight of 262.87 g/mol. IUPAC name: (4-bromo-2-ethoxy-6-fluorophenyl)boronic acid. InChIKey: QIAHCZUMIHBXQO-UHFFFAOYSA-N.
| Molecular formula | C8H9BBrFO3 |
|---|---|
| Molecular weight | 262.87 g/mol |
| IUPAC name | (4-bromo-2-ethoxy-6-fluorophenyl)boronic acid |
| InChIKey | QIAHCZUMIHBXQO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)Br)OCC)(O)O |
Computed by PubChem (NCBI)