cas: 161957-56-8 — see every product listed under this CAS number, including other names
3-Bromo-2-fluorobenzoic acid 98% (CAS 161957-56-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A243096-1g |
| cas | 161957-56-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 214.62 Pln | |
| Ambeed | 100g | 515.00 Pln | |
| Ambeed | 500g | 2206.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A243096 |
3-bromo-2-fluorobenzoic acid (CAS 161957-56-8) is a chemical compound with the molecular formula C7H4BrFO2 and a molecular weight of 219.01 g/mol. IUPAC name: 3-bromo-2-fluorobenzoic acid. InChIKey: UVKURTLVTLRSSM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO2 |
|---|---|
| Molecular weight | 219.01 g/mol |
| IUPAC name | 3-bromo-2-fluorobenzoic acid |
| InChIKey | UVKURTLVTLRSSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(=O)O |
Computed by PubChem (NCBI)