CAS 374554-41-3 is the registry number for 3-Bromo-2-fluorobenzoyl chloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 1g, 5g.
3-bromo-2-fluorobenzoyl chloride (CAS 374554-41-3) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 3-bromo-2-fluorobenzoyl chloride. InChIKey: MCRKBWVSQZTERQ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 3-bromo-2-fluorobenzoyl chloride |
| InChIKey | MCRKBWVSQZTERQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(=O)Cl |
Computed by PubChem (NCBI)