cas: 1310416-51-3 — see every product listed under this CAS number, including other names
3-Bromo-2-methylpyridine-6-carbonyl chloride, ≥95%, ≥95% (CAS 1310416-51-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K7ZJ-1g |
| cas | 1310416-51-3 |
| size | 1g |
| availability | 46g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1734.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-6-methylpyridine-2-carbonyl chloride (CAS 1310416-51-3) is a chemical compound with the molecular formula C7H5BrClNO and a molecular weight of 234.48 g/mol. IUPAC name: 5-bromo-6-methylpyridine-2-carbonyl chloride. InChIKey: MEJCGQNNKQPWHR-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO |
|---|---|
| Molecular weight | 234.48 g/mol |
| IUPAC name | 5-bromo-6-methylpyridine-2-carbonyl chloride |
| InChIKey | MEJCGQNNKQPWHR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C(=O)Cl)Br |
Computed by PubChem (NCBI)