CAS 1228826-41-2 appears in our catalog under these names: 4-Bromo-3-chlorobenzamide, 98%, 4-Bromo-3-chlorobenzamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
4-bromo-3-chlorobenzamide (CAS 1228826-41-2) is a chemical compound with the molecular formula C7H5BrClNO and a molecular weight of 234.48 g/mol. IUPAC name: 4-bromo-3-chlorobenzamide. InChIKey: OJJIBPRNEZNFNT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO |
|---|---|
| Molecular weight | 234.48 g/mol |
| IUPAC name | 4-bromo-3-chlorobenzamide |
| InChIKey | OJJIBPRNEZNFNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)Cl)Br |
Computed by PubChem (NCBI)