cas: 7138-15-0 — see every product listed under this CAS number, including other names
3-Bromo-2-nitroaniline, 97% (CAS 7138-15-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078031-1G |
| cas | 7138-15-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 200.99 Pln | |
| Fluorochem | 25g | 419.66 Pln | |
| Fluorochem | 100g | 1502.61 Pln | |
| Fluorochem | 500g | 6599.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-2-nitroaniline (CAS 7138-15-0) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 3-bromo-2-nitroaniline. InChIKey: GLKHLBAXHLAQBJ-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 3-bromo-2-nitroaniline |
| InChIKey | GLKHLBAXHLAQBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])N |
Computed by PubChem (NCBI)