CAS 114042-02-3 appears in our catalog under these names: 5–Bromo–3–methyl–2–nitropyridine, 5-Bromo-3-methyl-2-nitropyridine, 96%, 5-Bromo-3-methyl-2-nitropyridine 95%, 5-Bromo-3-methyl-2-nitropyridine, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 250mg.
5-bromo-3-methyl-2-nitropyridine (CAS 114042-02-3) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 5-bromo-3-methyl-2-nitropyridine. InChIKey: VKFNGESSJFKZEK-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 5-bromo-3-methyl-2-nitropyridine |
| InChIKey | VKFNGESSJFKZEK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)