CAS 7138-15-0 appears in our catalog under these names: 3-Bromo-2-nitroaniline, 98%, 3–Bromo–2–nitroaniline, 3-Bromo-2-nitroaniline, 98% , 3-Bromo-2-nitroaniline 98%, 3-Bromo-2-nitroaniline, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 500g.
3-bromo-2-nitroaniline (CAS 7138-15-0) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 3-bromo-2-nitroaniline. InChIKey: GLKHLBAXHLAQBJ-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 3-bromo-2-nitroaniline |
| InChIKey | GLKHLBAXHLAQBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])N |
Computed by PubChem (NCBI)