CAS 52834-08-9 appears in our catalog under these names: 4-Amino-5-bromo nicotinic acid, 95%, 4-Amino-5-bromonicotinic acid, 97%, 4-Amino-5-bromonicotinic acid, 95%, 95%, 4-Amino-5-bromonicotinic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 25g, 100g.
4-amino-5-bromopyridine-3-carboxylic acid (CAS 52834-08-9) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 4-amino-5-bromopyridine-3-carboxylic acid. InChIKey: HMWXBQBQGAZHEU-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 4-amino-5-bromopyridine-3-carboxylic acid |
| InChIKey | HMWXBQBQGAZHEU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)N)C(=O)O |
Computed by PubChem (NCBI)