CAS 35757-20-1 appears in our catalog under these names: 2-Bromo-3-nitroaniline, 95%, 2-Bromo-3-nitroaniline, 97%, 97%, 2-Bromo-3-nitroaniline, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg, 10g.
2-bromo-3-nitroaniline (CAS 35757-20-1) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 2-bromo-3-nitroaniline. InChIKey: GDKBUWQOCGJBFX-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2-bromo-3-nitroaniline |
| InChIKey | GDKBUWQOCGJBFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Br)N |
Computed by PubChem (NCBI)