cas: 6948-30-7 — see every product listed under this CAS number, including other names
3-Bromo-4,5-dimethoxybenzaldehyde, 95%, 95% (CAS 6948-30-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J20-10g |
| cas | 6948-30-7 |
| size | 10g |
| availability | 85.41g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 789.20 Pln | |
| Chemat | 50g | 3458.00 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 448.40 Pln | |
| Chemat | 25g | 1758.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4,5-dimethoxybenzaldehyde (CAS 6948-30-7) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 3-bromo-4,5-dimethoxybenzaldehyde. InChIKey: ICVODPFGWCUVJC-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 3-bromo-4,5-dimethoxybenzaldehyde |
| InChIKey | ICVODPFGWCUVJC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C=O)Br)OC |
Computed by PubChem (NCBI)