cas: 1214385-56-4 — see every product listed under this CAS number, including other names
3-Bromo-4-(trifluoromethyl)phenol, 97%, 97% (CAS 1214385-56-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125YE-1g |
| cas | 1214385-56-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 1528.40 Pln | |
| Chemat | 10g | 2262.80 Pln | |
| Chemat | 25g | 4461.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-(trifluoromethyl)phenol (CAS 1214385-56-4) is a chemical compound with the molecular formula C7H4BrF3O and a molecular weight of 241.00 g/mol. IUPAC name: 3-bromo-4-(trifluoromethyl)phenol. InChIKey: YWJMFYOMJODKJY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O |
|---|---|
| Molecular weight | 241.00 g/mol |
| IUPAC name | 3-bromo-4-(trifluoromethyl)phenol |
| InChIKey | YWJMFYOMJODKJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Br)C(F)(F)F |
Computed by PubChem (NCBI)