cas: 1678-49-5 — see every product listed under this CAS number, including other names
3-Bromo-4-Nitropyridine 1-Oxide, 98%, 98% (CAS 1678-49-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112XMJ-250mg |
| cas | 1678-49-5 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 25g | 534.80 Pln | |
| Chemat | 100g | 1514.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-nitro-1-oxidopyridin-1-ium (CAS 1678-49-5) is a chemical compound with the molecular formula C5H3BrN2O3 and a molecular weight of 218.99 g/mol. IUPAC name: 3-bromo-4-nitro-1-oxidopyridin-1-ium. InChIKey: YZQMKADIENBVLH-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O3 |
|---|---|
| Molecular weight | 218.99 g/mol |
| IUPAC name | 3-bromo-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | YZQMKADIENBVLH-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC(=C1[N+](=O)[O-])Br)[O-] |
Computed by PubChem (NCBI)