cas: 1678-49-5 — see every product listed under this CAS number, including other names
3-Bromo-4-nitropyridine 1-oxide, 98% (CAS 1678-49-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F068349-1G |
| cas | 1678-49-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 25g | 940.31 Pln | |
| Fluorochem | 100g | 3517.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-4-nitro-1-oxidopyridin-1-ium (CAS 1678-49-5) is a chemical compound with the molecular formula C5H3BrN2O3 and a molecular weight of 218.99 g/mol. IUPAC name: 3-bromo-4-nitro-1-oxidopyridin-1-ium. InChIKey: YZQMKADIENBVLH-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O3 |
|---|---|
| Molecular weight | 218.99 g/mol |
| IUPAC name | 3-bromo-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | YZQMKADIENBVLH-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC(=C1[N+](=O)[O-])Br)[O-] |
Computed by PubChem (NCBI)