cas: 855255-82-2 — see every product listed under this CAS number, including other names
3-Bromo-4-methylbiphenyl, 98% (CAS 855255-82-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632114-500MG |
| cas | 855255-82-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 643.54 Pln | |
| Fluorochem | 1g | 872.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-1-methyl-4-phenylbenzene (CAS 855255-82-2) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 2-bromo-1-methyl-4-phenylbenzene. InChIKey: BVTFEWBUBJTNHZ-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 2-bromo-1-methyl-4-phenylbenzene |
| InChIKey | BVTFEWBUBJTNHZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)