CAS 844856-52-6 appears in our catalog under these names: 3-Bromo-4'-methyl-1,1'-biphenyl, 98%, 98%, 3-Bromo-4'-methylbiphenyl, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1-methyl-4-phenylbenzene (CAS 844856-52-6) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 2-bromo-1-methyl-4-phenylbenzene. InChIKey: BVTFEWBUBJTNHZ-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 2-bromo-1-methyl-4-phenylbenzene |
| InChIKey | BVTFEWBUBJTNHZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)