cas: 101682-68-2 — see every product listed under this CAS number, including other names
3-Bromo-4-nitrobenzaldehyde, 97%, 97% (CAS 101682-68-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111683-5g |
| cas | 101682-68-2 |
| size | 5g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 894.80 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 25g | 4173.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-nitrobenzaldehyde (CAS 101682-68-2) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: 3-bromo-4-nitrobenzaldehyde. InChIKey: ZVNHPTMSLSAAET-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 3-bromo-4-nitrobenzaldehyde |
| InChIKey | ZVNHPTMSLSAAET-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)