cas: 114040-06-1 — see every product listed under this CAS number, including other names
3-Bromo-5,7-dichloropyrazolo[1,5-a]pyrimidine, 97%, 97% (CAS 114040-06-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ADN-100mg |
| cas | 114040-06-1 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 10g | 371.60 Pln | |
| Chemat | 25g | 832.40 Pln | |
| Chemat | 50g | 1566.80 Pln | |
| Chemat | 100g | 3016.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5,7-dichloropyrazolo[1,5-a]pyrimidine (CAS 114040-06-1) is a chemical compound with the molecular formula C6H2BrCl2N3 and a molecular weight of 266.91 g/mol. IUPAC name: 3-bromo-5,7-dichloropyrazolo[1,5-a]pyrimidine. InChIKey: CJIKMWXLGRVJMI-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2N3 |
|---|---|
| Molecular weight | 266.91 g/mol |
| IUPAC name | 3-bromo-5,7-dichloropyrazolo[1,5-a]pyrimidine |
| InChIKey | CJIKMWXLGRVJMI-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=C(C=N2)Br)N=C1Cl)Cl |
Computed by PubChem (NCBI)