Products 1008112-03-5
CAS 1008112-03-5 appears in our catalog under these names: 7-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine, 95%, 7-Bromo-2,4-dichloropyrrolo(2,1-f)(1,2,4)triazine, 97%, 7-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine 95%, 7-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine, 97%, 97%, 7-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 500mg.
7-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine (CAS 1008112-03-5) is a chemical compound with the molecular formula C6H2BrCl2N3 and a molecular weight of 266.91 g/mol. IUPAC name: 7-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine. InChIKey: BAWWEBPYOBYGPY-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2N3 |
|---|---|
| Molecular weight | 266.91 g/mol |
| IUPAC name | 7-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | BAWWEBPYOBYGPY-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=NN2C(=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)