CAS 1379351-34-4 is the registry number for 3-Bromo-6,8-dichloroimidazo(1,2-a)pyrazine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-bromo-6,8-dichloroimidazo[1,2-a]pyrazine (CAS 1379351-34-4) is a chemical compound with the molecular formula C6H2BrCl2N3 and a molecular weight of 266.91 g/mol. IUPAC name: 3-bromo-6,8-dichloroimidazo[1,2-a]pyrazine. InChIKey: YVWHXAFRJVDXTH-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2N3 |
|---|---|
| Molecular weight | 266.91 g/mol |
| IUPAC name | 3-bromo-6,8-dichloroimidazo[1,2-a]pyrazine |
| InChIKey | YVWHXAFRJVDXTH-UHFFFAOYSA-N |
| SMILES | C1=C(N2C=C(N=C(C2=N1)Cl)Cl)Br |
Computed by PubChem (NCBI)