CAS 2414520-09-3 is the registry number for 8-Bromo-3,5-dichloroimidazo[1,2-c]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-3,5-dichloroimidazo[1,2-c]pyrimidine (CAS 2414520-09-3) is a chemical compound with the molecular formula C6H2BrCl2N3 and a molecular weight of 266.91 g/mol. IUPAC name: 8-bromo-3,5-dichloroimidazo[1,2-c]pyrimidine. InChIKey: FVKIELTVIYOJFY-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2N3 |
|---|---|
| Molecular weight | 266.91 g/mol |
| IUPAC name | 8-bromo-3,5-dichloroimidazo[1,2-c]pyrimidine |
| InChIKey | FVKIELTVIYOJFY-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC=C(N2C(=N1)Cl)Cl)Br |
Computed by PubChem (NCBI)