CAS 1160995-23-2 appears in our catalog under these names: 6-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine, 95%, 6-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine 98%, 6-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine, 98%, 98%, 6-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 25g, 500mg.
6-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine (CAS 1160995-23-2) is a chemical compound with the molecular formula C6H2BrCl2N3 and a molecular weight of 266.91 g/mol. IUPAC name: 6-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine. InChIKey: NRVGOQKEQWXMOO-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2N3 |
|---|---|
| Molecular weight | 266.91 g/mol |
| IUPAC name | 6-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | NRVGOQKEQWXMOO-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=NN2C=C1Br)Cl)Cl |
Computed by PubChem (NCBI)